C25H35N6Na2+ — CID 165140740
disodium;(1Z)-4-[2-[1-(benzylamino)ethenyl]pyrrolidin-1-yl]-2-hydrazinylpenta-1,4-dien-1-amine;2-methanidylaniline (PubChem CID 165140740) has the molecular formula C25H35N6Na2+ and a molecular weight of 465.58 g/mol. Its IUPAC name is disodium;(1Z)-4-[2-[1-(benzylamino)ethenyl]pyrrolidin-1-yl]-2-hydrazinylpenta-1,4-dien-1-amine;2-methanidylaniline.
| Compound Name | disodium;(1Z)-4-[2-[1-(benzylamino)ethenyl]pyrrolidin-1-yl]-2-hydrazinylpenta-1,4-dien-1-amine;2-methanidylaniline |
|---|---|
| PubChem CID | 165140740 |
| Molecular Formula | C25H35N6Na2+ |
| Molecular Weight | 465.58 g/mol |
| Exact Mass | 465.27 |
| IUPAC Name | disodium;(1Z)-4-[2-[1-(benzylamino)ethenyl]pyrrolidin-1-yl]-2-hydrazinylpenta-1,4-dien-1-amine;2-methanidylaniline |
| SMILES | C=C(NCc1ccccc1)C1CCCN1C(=C)C/C(=C/N)NN.[CH2-]c1ccccc1N.[Na+].[Na+] |
| InChI | InChI=1S/C18H27N5.C7H8N.2Na/c1-14(11-17(12-19)22-20)23-10-6-9-18(23)15(2)21-13-16-7-4-3-5-8-16;1-6-4-2-3-5-7(6)8;;/h3-5,7-8,12,18,21-22H,1-2,6,9-11,13,19-20H2;2-5H,1,8H2;;/q;-1;2*+1/b17-12-;;; |
| InChIKey | USUBKUWHLMIDER-NDOZRWCBSA-N |
| XLogP | -2.62 |
| TPSA | 105.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.58 |
| LogP ≤ 5 | -2.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|