C24H24N4O8S — CID 165140960
2-[[(5S)-5-ethyl-5-hydroxy-6,10-dioxo-7,18,20-trioxa-11,24-diazahexacyclo[11.11.0.02,11.04,9.015,23.017,21]tetracosa-1(24),2,4(9),13,15,17(21),22-heptaen-14-yl]methylamino]ethanesulfonamide (PubChem CID 165140960) has the molecular formula C24H24N4O8S and a molecular weight of 528.54 g/mol. Its IUPAC name is 2-[[(5S)-5-ethyl-5-hydroxy-6,10-dioxo-7,18,20-trioxa-11,24-diazahexacyclo[11.11.0.02,11.04,9.015,23.017,21]tetracosa-1(24),2,4(9),13,15,17(21),22-heptaen-14-yl]methylamino]ethanesulfonamide.
| Compound Name | 2-[[(5S)-5-ethyl-5-hydroxy-6,10-dioxo-7,18,20-trioxa-11,24-diazahexacyclo[11.11.0.02,11.04,9.015,23.017,21]tetracosa-1(24),2,4(9),13,15,17(21),22-heptaen-14-yl]methylamino]ethanesulfonamide |
|---|---|
| PubChem CID | 165140960 |
| Molecular Formula | C24H24N4O8S |
| Molecular Weight | 528.54 g/mol |
| Exact Mass | 528.13 |
| IUPAC Name | 2-[[(5S)-5-ethyl-5-hydroxy-6,10-dioxo-7,18,20-trioxa-11,24-diazahexacyclo[11.11.0.02,11.04,9.015,23.017,21]tetracosa-1(24),2,4(9),13,15,17(21),22-heptaen-14-yl]methylamino]ethanesulfonamide |
| SMILES | CC[C@@]1(O)C(=O)OCc2c1cc1n(c2=O)Cc2c-1nc1cc3c(cc1c2CNCCS(N)(=O)=O)OCO3 |
| InChI | InChI=1S/C24H24N4O8S/c1-2-24(31)16-6-18-21-14(9-28(18)22(29)15(16)10-34-23(24)30)13(8-26-3-4-37(25,32)33)12-5-19-20(36-11-35-19)7-17(12)27-21/h5-7,26,31H,2-4,8-11H2,1H3,(H2,25,32,33)/t24-/m0/s1 |
| InChIKey | QYTVTZCJWCMLJP-DEOSSOPVSA-N |
| XLogP | 0.19 |
| TPSA | 172.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.54 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|