C13H24N2O3S — CID 165141180
formaldehyde;thiohydroxylamine;1-(2,4,4-trimethylpentan-2-yl)pyrrole-2,5-dione (PubChem CID 165141180) has the molecular formula C13H24N2O3S and a molecular weight of 288.41 g/mol. Its IUPAC name is formaldehyde;thiohydroxylamine;1-(2,4,4-trimethylpentan-2-yl)pyrrole-2,5-dione.
| Compound Name | formaldehyde;thiohydroxylamine;1-(2,4,4-trimethylpentan-2-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 165141180 |
| Molecular Formula | C13H24N2O3S |
| Molecular Weight | 288.41 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | formaldehyde;thiohydroxylamine;1-(2,4,4-trimethylpentan-2-yl)pyrrole-2,5-dione |
| SMILES | C=O.CC(C)(C)CC(C)(C)N1C(=O)C=CC1=O.NS |
| InChI | InChI=1S/C12H19NO2.CH2O.H3NS/c1-11(2,3)8-12(4,5)13-9(14)6-7-10(13)15;2*1-2/h6-7H,8H2,1-5H3;1H2;2H,1H2 |
| InChIKey | LSLGGLVVPXOLSV-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.41 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|