C24H20ClFN4O5 — CID 165141279
6-chloro-7-(2-fluoro-6-methoxyphenyl)-1-(4-methyl-2-propan-2-yl-3-pyridinyl)-3-nitro-1,8-naphthyridine-2,4-dione (PubChem CID 165141279) has the molecular formula C24H20ClFN4O5 and a molecular weight of 498.90 g/mol. Its IUPAC name is 6-chloro-7-(2-fluoro-6-methoxyphenyl)-1-(4-methyl-2-propan-2-yl-3-pyridinyl)-3-nitro-1,8-naphthyridine-2,4-dione.
| Compound Name | 6-chloro-7-(2-fluoro-6-methoxyphenyl)-1-(4-methyl-2-propan-2-yl-3-pyridinyl)-3-nitro-1,8-naphthyridine-2,4-dione |
|---|---|
| PubChem CID | 165141279 |
| Molecular Formula | C24H20ClFN4O5 |
| Molecular Weight | 498.90 g/mol |
| Exact Mass | 498.11 |
| IUPAC Name | 6-chloro-7-(2-fluoro-6-methoxyphenyl)-1-(4-methyl-2-propan-2-yl-3-pyridinyl)-3-nitro-1,8-naphthyridine-2,4-dione |
| SMILES | COc1cccc(F)c1-c1nc2c(cc1Cl)C(=O)C([N+](=O)[O-])C(=O)N2c1c(C)ccnc1C(C)C |
| InChI | InChI=1S/C24H20ClFN4O5/c1-11(2)18-20(12(3)8-9-27-18)29-23-13(22(31)21(24(29)32)30(33)34)10-14(25)19(28-23)17-15(26)6-5-7-16(17)35-4/h5-11,21H,1-4H3 |
| InChIKey | IJALWCMCZAPKPT-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 115.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.90 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|