C15H17N5O4S — CID 165141445
6-(4-methylsulfonylpiperazine-1-carbonyl)-4-phenyl-1H-1,3,5-triazin-2-one (PubChem CID 165141445) has the molecular formula C15H17N5O4S and a molecular weight of 363.40 g/mol. Its IUPAC name is 6-(4-methylsulfonylpiperazine-1-carbonyl)-4-phenyl-1H-1,3,5-triazin-2-one.
| Compound Name | 6-(4-methylsulfonylpiperazine-1-carbonyl)-4-phenyl-1H-1,3,5-triazin-2-one |
|---|---|
| PubChem CID | 165141445 |
| Molecular Formula | C15H17N5O4S |
| Molecular Weight | 363.40 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | 6-(4-methylsulfonylpiperazine-1-carbonyl)-4-phenyl-1H-1,3,5-triazin-2-one |
| SMILES | CS(=O)(=O)N1CCN(C(=O)c2nc(-c3ccccc3)nc(=O)[nH]2)CC1 |
| InChI | InChI=1S/C15H17N5O4S/c1-25(23,24)20-9-7-19(8-10-20)14(21)13-16-12(17-15(22)18-13)11-5-3-2-4-6-11/h2-6H,7-10H2,1H3,(H,16,17,18,22) |
| InChIKey | QLNSGYFJZUYFPT-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 116.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.40 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |