About [2-(3-chloro-4-fluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propyl] 2,2-dimethylpropanoate
[2-(3-chloro-4-fluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propyl] 2,2-dimethylpropanoate (PubChem CID 165141664) has the molecular formula C19H27ClFNO4
and a molecular weight of 387.88 g/mol. Its IUPAC name is [2-(3-chloro-4-fluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propyl] 2,2-dimethylpropanoate.
Molecular Properties
| Compound Name | [2-(3-chloro-4-fluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propyl] 2,2-dimethylpropanoate |
| PubChem CID | 165141664 |
| Molecular Formula | C19H27ClFNO4 |
| Molecular Weight | 387.88 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | [2-(3-chloro-4-fluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propyl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)OC(=O)NC(C)(COC(=O)C(C)(C)C)c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C19H27ClFNO4/c1-17(2,3)15(23)25-11-19(7,22-16(24)26-18(4,5)6)12-8-9-14(21)13(20)10-12/h8-10H,11H2,1-7H3,(H,22,24) |
| InChIKey | VLILDCJIFDHWLT-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.88 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-(3-chloro-4-fluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propyl] 2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(3-chloro-4-fluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propyl] 2,2-dimethylpropanoate?
The IUPAC name of [2-(3-chloro-4-fluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propyl] 2,2-dimethylpropanoate (CID 165141664) is [2-(3-chloro-4-fluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propyl] 2,2-dimethylpropanoate.
What is the SMILES notation for [2-(3-chloro-4-fluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propyl] 2,2-dimethylpropanoate?
The canonical SMILES for [2-(3-chloro-4-fluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propyl] 2,2-dimethylpropanoate is CC(C)(C)OC(=O)NC(C)(COC(=O)C(C)(C)C)c1ccc(F)c(Cl)c1.
What is the InChIKey of [2-(3-chloro-4-fluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propyl] 2,2-dimethylpropanoate?
The InChIKey is VLILDCJIFDHWLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H27ClFNO4/c1-17(2,3)15(23)25-11-19(7,22-16(24)26-18(4,5)6)12-8-9-14(21)13(20)10-12/h8-10H,11H2,1-7H3,(H,22,24).
What are the key properties of [2-(3-chloro-4-fluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propyl] 2,2-dimethylpropanoate?
[2-(3-chloro-4-fluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propyl] 2,2-dimethylpropanoate has a molecular weight of 387.88 g/mol, XLogP of 4.81, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(3-chloro-4-fluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propyl] 2,2-dimethylpropanoate is sourced from PubChem (CID 165141664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).