C16H24F2N2 — CID 165142129
(2S,4R)-2-(3,4-difluorophenyl)-N-ethyl-1-propan-2-ylpiperidin-4-amine (PubChem CID 165142129) has the molecular formula C16H24F2N2 and a molecular weight of 282.38 g/mol. Its IUPAC name is (2S,4R)-2-(3,4-difluorophenyl)-N-ethyl-1-propan-2-ylpiperidin-4-amine.
| Compound Name | (2S,4R)-2-(3,4-difluorophenyl)-N-ethyl-1-propan-2-ylpiperidin-4-amine |
|---|---|
| PubChem CID | 165142129 |
| Molecular Formula | C16H24F2N2 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.19 |
| IUPAC Name | (2S,4R)-2-(3,4-difluorophenyl)-N-ethyl-1-propan-2-ylpiperidin-4-amine |
| SMILES | CCN[C@@H]1CCN(C(C)C)[C@H](c2ccc(F)c(F)c2)C1 |
| InChI | InChI=1S/C16H24F2N2/c1-4-19-13-7-8-20(11(2)3)16(10-13)12-5-6-14(17)15(18)9-12/h5-6,9,11,13,16,19H,4,7-8,10H2,1-3H3/t13-,16+/m1/s1 |
| InChIKey | AEMVWWMYHTYXBZ-CJNGLKHVSA-N |
| XLogP | 3.49 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |