About ethenol;methane;methyl 1-(2,2-dimethylpropyl)-2,3-dihydroindole-6-carboxylate
ethenol;methane;methyl 1-(2,2-dimethylpropyl)-2,3-dihydroindole-6-carboxylate (PubChem CID 165142730) has the molecular formula C18H29NO3
and a molecular weight of 307.43 g/mol. Its IUPAC name is ethenol;methane;methyl 1-(2,2-dimethylpropyl)-2,3-dihydroindole-6-carboxylate.
Molecular Properties
| Compound Name | ethenol;methane;methyl 1-(2,2-dimethylpropyl)-2,3-dihydroindole-6-carboxylate |
| PubChem CID | 165142730 |
| Molecular Formula | C18H29NO3 |
| Molecular Weight | 307.43 g/mol |
| Exact Mass | 307.21 |
| IUPAC Name | ethenol;methane;methyl 1-(2,2-dimethylpropyl)-2,3-dihydroindole-6-carboxylate |
| SMILES | C.C=CO.COC(=O)c1ccc2c(c1)N(CC(C)(C)C)CC2 |
| InChI | InChI=1S/C15H21NO2.C2H4O.CH4/c1-15(2,3)10-16-8-7-11-5-6-12(9-13(11)16)14(17)18-4;1-2-3;/h5-6,9H,7-8,10H2,1-4H3;2-3H,1H2;1H4 |
| InChIKey | NLLPPEBTZWQTEF-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.43 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze ethenol;methane;methyl 1-(2,2-dimethylpropyl)-2,3-dihydroindole-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethenol;methane;methyl 1-(2,2-dimethylpropyl)-2,3-dihydroindole-6-carboxylate?
The IUPAC name of ethenol;methane;methyl 1-(2,2-dimethylpropyl)-2,3-dihydroindole-6-carboxylate (CID 165142730) is ethenol;methane;methyl 1-(2,2-dimethylpropyl)-2,3-dihydroindole-6-carboxylate.
What is the SMILES notation for ethenol;methane;methyl 1-(2,2-dimethylpropyl)-2,3-dihydroindole-6-carboxylate?
The canonical SMILES for ethenol;methane;methyl 1-(2,2-dimethylpropyl)-2,3-dihydroindole-6-carboxylate is C.C=CO.COC(=O)c1ccc2c(c1)N(CC(C)(C)C)CC2.
What is the InChIKey of ethenol;methane;methyl 1-(2,2-dimethylpropyl)-2,3-dihydroindole-6-carboxylate?
The InChIKey is NLLPPEBTZWQTEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21NO2.C2H4O.CH4/c1-15(2,3)10-16-8-7-11-5-6-12(9-13(11)16)14(17)18-4;1-2-3;/h5-6,9H,7-8,10H2,1-4H3;2-3H,1H2;1H4.
What are the key properties of ethenol;methane;methyl 1-(2,2-dimethylpropyl)-2,3-dihydroindole-6-carboxylate?
ethenol;methane;methyl 1-(2,2-dimethylpropyl)-2,3-dihydroindole-6-carboxylate has a molecular weight of 307.43 g/mol, XLogP of 4.21, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethenol;methane;methyl 1-(2,2-dimethylpropyl)-2,3-dihydroindole-6-carboxylate is sourced from PubChem (CID 165142730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).