C15H18F3N3OS — CID 165142837
N-[(E)-1-amino-5,5,5-trifluoro-4,4-dimethylpent-2-enylidene]-4,5,6,7-tetrahydrothieno[2,3-c]pyridine-3-carboxamide (PubChem CID 165142837) has the molecular formula C15H18F3N3OS and a molecular weight of 345.39 g/mol. Its IUPAC name is N-[(E)-1-amino-5,5,5-trifluoro-4,4-dimethylpent-2-enylidene]-4,5,6,7-tetrahydrothieno[2,3-c]pyridine-3-carboxamide.
| Compound Name | N-[(E)-1-amino-5,5,5-trifluoro-4,4-dimethylpent-2-enylidene]-4,5,6,7-tetrahydrothieno[2,3-c]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 165142837 |
| Molecular Formula | C15H18F3N3OS |
| Molecular Weight | 345.39 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | N-[(E)-1-amino-5,5,5-trifluoro-4,4-dimethylpent-2-enylidene]-4,5,6,7-tetrahydrothieno[2,3-c]pyridine-3-carboxamide |
| SMILES | CC(C)(/C=C/C(N)=N/C(=O)c1csc2c1CCNC2)C(F)(F)F |
| InChI | InChI=1S/C15H18F3N3OS/c1-14(2,15(16,17)18)5-3-12(19)21-13(22)10-8-23-11-7-20-6-4-9(10)11/h3,5,8,20H,4,6-7H2,1-2H3,(H2,19,21,22)/b5-3+ |
| InChIKey | BVZWQPBVLZZLKX-HWKANZROSA-N |
| XLogP | 3.04 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.39 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|