C20H21F3N6O2S — CID 165142866
6-[(2-aminopyrimidin-5-yl)methyl]-N-[5-(1,1,1-trifluoro-2-methylpropan-2-yl)-1,2-oxazol-3-yl]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxamide (PubChem CID 165142866) has the molecular formula C20H21F3N6O2S and a molecular weight of 466.49 g/mol. Its IUPAC name is 6-[(2-aminopyrimidin-5-yl)methyl]-N-[5-(1,1,1-trifluoro-2-methylpropan-2-yl)-1,2-oxazol-3-yl]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxamide.
| Compound Name | 6-[(2-aminopyrimidin-5-yl)methyl]-N-[5-(1,1,1-trifluoro-2-methylpropan-2-yl)-1,2-oxazol-3-yl]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 165142866 |
| Molecular Formula | C20H21F3N6O2S |
| Molecular Weight | 466.49 g/mol |
| Exact Mass | 466.14 |
| IUPAC Name | 6-[(2-aminopyrimidin-5-yl)methyl]-N-[5-(1,1,1-trifluoro-2-methylpropan-2-yl)-1,2-oxazol-3-yl]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxamide |
| SMILES | CC(C)(c1cc(NC(=O)c2csc3c2CCN(Cc2cnc(N)nc2)C3)no1)C(F)(F)F |
| InChI | InChI=1S/C20H21F3N6O2S/c1-19(2,20(21,22)23)15-5-16(28-31-15)27-17(30)13-10-32-14-9-29(4-3-12(13)14)8-11-6-25-18(24)26-7-11/h5-7,10H,3-4,8-9H2,1-2H3,(H2,24,25,26)(H,27,28,30) |
| InChIKey | AETOWUJWNZYQAU-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 110.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.49 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |