C19H23N3O2S — CID 165143014
(2E)-1-(3-acetyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-yl)-2-(aminomethylidene)-3-[(1Z)-buta-1,3-dienyl]iminopentan-1-one (PubChem CID 165143014) has the molecular formula C19H23N3O2S and a molecular weight of 357.48 g/mol. Its IUPAC name is (2E)-1-(3-acetyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-yl)-2-(aminomethylidene)-3-[(1Z)-buta-1,3-dienyl]iminopentan-1-one.
| Compound Name | (2E)-1-(3-acetyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-yl)-2-(aminomethylidene)-3-[(1Z)-buta-1,3-dienyl]iminopentan-1-one |
|---|---|
| PubChem CID | 165143014 |
| Molecular Formula | C19H23N3O2S |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | (2E)-1-(3-acetyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-yl)-2-(aminomethylidene)-3-[(1Z)-buta-1,3-dienyl]iminopentan-1-one |
| SMILES | C=C/C=C\N=C(CC)\C(=C/N)C(=O)N1CCc2c(C(C)=O)csc2C1 |
| InChI | InChI=1S/C19H23N3O2S/c1-4-6-8-21-17(5-2)15(10-20)19(24)22-9-7-14-16(13(3)23)12-25-18(14)11-22/h4,6,8,10,12H,1,5,7,9,11,20H2,2-3H3/b8-6-,15-10+,21-17+ |
| InChIKey | IORJAJOHCUMVBW-QEKHRFRNSA-N |
| XLogP | 3.23 |
| TPSA | 75.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|