C15H21N3O2S — CID 165143044
N-[(Z)-3-amino-4,4-dimethylpent-2-enoyl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridine-3-carboxamide (PubChem CID 165143044) has the molecular formula C15H21N3O2S and a molecular weight of 307.42 g/mol. Its IUPAC name is N-[(Z)-3-amino-4,4-dimethylpent-2-enoyl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridine-3-carboxamide.
| Compound Name | N-[(Z)-3-amino-4,4-dimethylpent-2-enoyl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 165143044 |
| Molecular Formula | C15H21N3O2S |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | N-[(Z)-3-amino-4,4-dimethylpent-2-enoyl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridine-3-carboxamide |
| SMILES | CC(C)(C)/C(N)=C/C(=O)NC(=O)c1csc2c1CCNC2 |
| InChI | InChI=1S/C15H21N3O2S/c1-15(2,3)12(16)6-13(19)18-14(20)10-8-21-11-7-17-5-4-9(10)11/h6,8,17H,4-5,7,16H2,1-3H3,(H,18,19,20)/b12-6- |
| InChIKey | RZOKWZXHURWQLQ-SDQBBNPISA-N |
| XLogP | 1.54 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|