C27H43N3OS — CID 165143074
(4Z,6Z)-2,3-dimethylocta-2,4,6-triene;N-methyl-6-[(E)-2-methylbut-2-enimidoyl]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxamide;propane (PubChem CID 165143074) has the molecular formula C27H43N3OS and a molecular weight of 457.73 g/mol. Its IUPAC name is (4Z,6Z)-2,3-dimethylocta-2,4,6-triene;N-methyl-6-[(E)-2-methylbut-2-enimidoyl]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxamide;propane.
| Compound Name | (4Z,6Z)-2,3-dimethylocta-2,4,6-triene;N-methyl-6-[(E)-2-methylbut-2-enimidoyl]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxamide;propane |
|---|---|
| PubChem CID | 165143074 |
| Molecular Formula | C27H43N3OS |
| Molecular Weight | 457.73 g/mol |
| Exact Mass | 457.31 |
| IUPAC Name | (4Z,6Z)-2,3-dimethylocta-2,4,6-triene;N-methyl-6-[(E)-2-methylbut-2-enimidoyl]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxamide;propane |
| SMILES | C/C=C\C=C/C(C)=C(C)C.CCC.[H]/N=C(C(\C)=C\C)/N1CCc2c(C(=O)NC)csc2C1 |
| InChI | InChI=1S/C14H19N3OS.C10H16.C3H8/c1-4-9(2)13(15)17-6-5-10-11(14(18)16-3)8-19-12(10)7-17;1-5-6-7-8-10(4)9(2)3;1-3-2/h4,8,15H,5-7H2,1-3H3,(H,16,18);5-8H,1-4H3;3H2,1-2H3/b9-4+,15-13+;6-5-,8-7-; |
| InChIKey | AXMOGNCELVSVOX-FXDAMYFOSA-N |
| XLogP | 7.30 |
| TPSA | 56.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.73 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|