C34H51N3O2S — CID 165143124
N-[(E)-1-amino-4,4-dimethylpent-2-enylidene]-6-[(E)-2-methylbut-2-enoyl]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxamide;(5Z,7Z)-3,4,9-trimethylundeca-3,5,7-triene (PubChem CID 165143124) has the molecular formula C34H51N3O2S and a molecular weight of 565.87 g/mol. Its IUPAC name is N-[(E)-1-amino-4,4-dimethylpent-2-enylidene]-6-[(E)-2-methylbut-2-enoyl]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxamide;(5Z,7Z)-3,4,9-trimethylundeca-3,5,7-triene.
| Compound Name | N-[(E)-1-amino-4,4-dimethylpent-2-enylidene]-6-[(E)-2-methylbut-2-enoyl]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxamide;(5Z,7Z)-3,4,9-trimethylundeca-3,5,7-triene |
|---|---|
| PubChem CID | 165143124 |
| Molecular Formula | C34H51N3O2S |
| Molecular Weight | 565.87 g/mol |
| Exact Mass | 565.37 |
| IUPAC Name | N-[(E)-1-amino-4,4-dimethylpent-2-enylidene]-6-[(E)-2-methylbut-2-enoyl]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxamide;(5Z,7Z)-3,4,9-trimethylundeca-3,5,7-triene |
| SMILES | C/C=C(\C)C(=O)N1CCc2c(C(=O)/N=C(N)/C=C/C(C)(C)C)csc2C1.CCC(C)=C(C)/C=C\C=C/C(C)CC |
| InChI | InChI=1S/C20H27N3O2S.C14H24/c1-6-13(2)19(25)23-10-8-14-15(12-26-16(14)11-23)18(24)22-17(21)7-9-20(3,4)5;1-6-12(3)10-8-9-11-14(5)13(4)7-2/h6-7,9,12H,8,10-11H2,1-5H3,(H2,21,22,24);8-12H,6-7H2,1-5H3/b9-7+,13-6+;10-8-,11-9-,14-13? |
| InChIKey | OVJNXPOTKZTWFM-IXKJKKCJSA-N |
| XLogP | 8.59 |
| TPSA | 75.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.87 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|