C24H32F3N3O2S — CID 165143692
6-[(E)-2-methylbut-2-enoyl]-N'-[(3Z,5Z)-8,8,8-trifluoro-6-methoxy-7,7-dimethylocta-3,5-dien-4-yl]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboximidamide (PubChem CID 165143692) has the molecular formula C24H32F3N3O2S and a molecular weight of 483.60 g/mol. Its IUPAC name is 6-[(E)-2-methylbut-2-enoyl]-N'-[(3Z,5Z)-8,8,8-trifluoro-6-methoxy-7,7-dimethylocta-3,5-dien-4-yl]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboximidamide.
| Compound Name | 6-[(E)-2-methylbut-2-enoyl]-N'-[(3Z,5Z)-8,8,8-trifluoro-6-methoxy-7,7-dimethylocta-3,5-dien-4-yl]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboximidamide |
|---|---|
| PubChem CID | 165143692 |
| Molecular Formula | C24H32F3N3O2S |
| Molecular Weight | 483.60 g/mol |
| Exact Mass | 483.22 |
| IUPAC Name | 6-[(E)-2-methylbut-2-enoyl]-N'-[(3Z,5Z)-8,8,8-trifluoro-6-methoxy-7,7-dimethylocta-3,5-dien-4-yl]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboximidamide |
| SMILES | C/C=C(\C)C(=O)N1CCc2c(/C(N)=N/C(=C\CC)/C=C(\OC)C(C)(C)C(F)(F)F)csc2C1 |
| InChI | InChI=1S/C24H32F3N3O2S/c1-7-9-16(12-20(32-6)23(4,5)24(25,26)27)29-21(28)18-14-33-19-13-30(11-10-17(18)19)22(31)15(3)8-2/h8-9,12,14H,7,10-11,13H2,1-6H3,(H2,28,29)/b15-8+,16-9-,20-12- |
| InChIKey | UIYDSXIATZUREH-LDNKYBOASA-N |
| XLogP | 5.72 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.60 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|