C12H11F4NO3 — CID 165144054
3-[(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)oxy]cyclobutan-1-amine (PubChem CID 165144054) has the molecular formula C12H11F4NO3 and a molecular weight of 293.22 g/mol. Its IUPAC name is 3-[(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)oxy]cyclobutan-1-amine.
| Compound Name | 3-[(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)oxy]cyclobutan-1-amine |
|---|---|
| PubChem CID | 165144054 |
| Molecular Formula | C12H11F4NO3 |
| Molecular Weight | 293.22 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | 3-[(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)oxy]cyclobutan-1-amine |
| SMILES | NC1CC(Oc2ccc3c(c2)OC(F)(F)C(F)(F)O3)C1 |
| InChI | InChI=1S/C12H11F4NO3/c13-11(14)12(15,16)20-10-5-7(1-2-9(10)19-11)18-8-3-6(17)4-8/h1-2,5-6,8H,3-4,17H2 |
| InChIKey | XLEJSSBADDIXPP-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.22 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|