C26H36Cl3N3O2 — CID 165144815
3-(3-amino-5-methylphenyl)-2,2-dichlorocyclopropane-1-carbaldehyde;4-chloro-3-N-(3-ethoxybut-1-en-2-yl)-1-N-methylbenzene-1,3-diamine;ethane (PubChem CID 165144815) has the molecular formula C26H36Cl3N3O2 and a molecular weight of 528.95 g/mol. Its IUPAC name is 3-(3-amino-5-methylphenyl)-2,2-dichlorocyclopropane-1-carbaldehyde;4-chloro-3-N-(3-ethoxybut-1-en-2-yl)-1-N-methylbenzene-1,3-diamine;ethane.
| Compound Name | 3-(3-amino-5-methylphenyl)-2,2-dichlorocyclopropane-1-carbaldehyde;4-chloro-3-N-(3-ethoxybut-1-en-2-yl)-1-N-methylbenzene-1,3-diamine;ethane |
|---|---|
| PubChem CID | 165144815 |
| Molecular Formula | C26H36Cl3N3O2 |
| Molecular Weight | 528.95 g/mol |
| Exact Mass | 527.19 |
| IUPAC Name | 3-(3-amino-5-methylphenyl)-2,2-dichlorocyclopropane-1-carbaldehyde;4-chloro-3-N-(3-ethoxybut-1-en-2-yl)-1-N-methylbenzene-1,3-diamine;ethane |
| SMILES | C=C(Nc1cc(NC)ccc1Cl)C(C)OCC.CC.Cc1cc(N)cc(C2C(C=O)C2(Cl)Cl)c1 |
| InChI | InChI=1S/C13H19ClN2O.C11H11Cl2NO.C2H6/c1-5-17-10(3)9(2)16-13-8-11(15-4)6-7-12(13)14;1-6-2-7(4-8(14)3-6)10-9(5-15)11(10,12)13;1-2/h6-8,10,15-16H,2,5H2,1,3-4H3;2-5,9-10H,14H2,1H3;1-2H3 |
| InChIKey | REGAUTFTXAMFJK-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.95 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|