About ethyl (2R,4R)-2-ethylpiperidine-4-carboxylate;hydrochloride
ethyl (2R,4R)-2-ethylpiperidine-4-carboxylate;hydrochloride (PubChem CID 165145324) has the molecular formula C10H20ClNO2
and a molecular weight of 221.73 g/mol. Its IUPAC name is ethyl (2R,4R)-2-ethylpiperidine-4-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | ethyl (2R,4R)-2-ethylpiperidine-4-carboxylate;hydrochloride |
| PubChem CID | 165145324 |
| Molecular Formula | C10H20ClNO2 |
| Molecular Weight | 221.73 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | ethyl (2R,4R)-2-ethylpiperidine-4-carboxylate;hydrochloride |
| SMILES | CCOC(=O)[C@@H]1CCN[C@H](CC)C1.Cl |
| InChI | InChI=1S/C10H19NO2.ClH/c1-3-9-7-8(5-6-11-9)10(12)13-4-2;/h8-9,11H,3-7H2,1-2H3;1H/t8-,9-;/m1./s1 |
| InChIKey | SAEQXMVBTXUOPJ-VTLYIQCISA-N |
| XLogP | 1.75 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.73 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl (2R,4R)-2-ethylpiperidine-4-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (2R,4R)-2-ethylpiperidine-4-carboxylate;hydrochloride?
The IUPAC name of ethyl (2R,4R)-2-ethylpiperidine-4-carboxylate;hydrochloride (CID 165145324) is ethyl (2R,4R)-2-ethylpiperidine-4-carboxylate;hydrochloride.
What is the SMILES notation for ethyl (2R,4R)-2-ethylpiperidine-4-carboxylate;hydrochloride?
The canonical SMILES for ethyl (2R,4R)-2-ethylpiperidine-4-carboxylate;hydrochloride is CCOC(=O)[C@@H]1CCN[C@H](CC)C1.Cl.
What is the InChIKey of ethyl (2R,4R)-2-ethylpiperidine-4-carboxylate;hydrochloride?
The InChIKey is SAEQXMVBTXUOPJ-VTLYIQCISA-N. The full InChI is InChI=1S/C10H19NO2.ClH/c1-3-9-7-8(5-6-11-9)10(12)13-4-2;/h8-9,11H,3-7H2,1-2H3;1H/t8-,9-;/m1./s1.
What are the key properties of ethyl (2R,4R)-2-ethylpiperidine-4-carboxylate;hydrochloride?
ethyl (2R,4R)-2-ethylpiperidine-4-carboxylate;hydrochloride has a molecular weight of 221.73 g/mol, XLogP of 1.75, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (2R,4R)-2-ethylpiperidine-4-carboxylate;hydrochloride is sourced from PubChem (CID 165145324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).