C11H10N2O — CID 165145733
2-oxo-1,3,4,5-tetrahydro-1-benzazepine-5-carbonitrile (PubChem CID 165145733) has the molecular formula C11H10N2O and a molecular weight of 186.21 g/mol. Its IUPAC name is 2-oxo-1,3,4,5-tetrahydro-1-benzazepine-5-carbonitrile.
| Compound Name | 2-oxo-1,3,4,5-tetrahydro-1-benzazepine-5-carbonitrile |
|---|---|
| PubChem CID | 165145733 |
| Molecular Formula | C11H10N2O |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.08 |
| IUPAC Name | 2-oxo-1,3,4,5-tetrahydro-1-benzazepine-5-carbonitrile |
| SMILES | N#CC1CCC(=O)Nc2ccccc21 |
| InChI | InChI=1S/C11H10N2O/c12-7-8-5-6-11(14)13-10-4-2-1-3-9(8)10/h1-4,8H,5-6H2,(H,13,14) |
| InChIKey | ORZAIGADWIDFKA-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |