C69H53N3O2 — CID 165148441
3-[4-[2-[3,5-bis[2-(4-pyridin-2-ylphenoxy)propan-2-yl]phenyl]phenyl]phenyl]-7-phenylphenanthro[9,10-c]pyridine (PubChem CID 165148441) has the molecular formula C69H53N3O2 and a molecular weight of 956.20 g/mol. Its IUPAC name is 3-[4-[2-[3,5-bis[2-(4-pyridin-2-ylphenoxy)propan-2-yl]phenyl]phenyl]phenyl]-7-phenylphenanthro[9,10-c]pyridine.
| Compound Name | 3-[4-[2-[3,5-bis[2-(4-pyridin-2-ylphenoxy)propan-2-yl]phenyl]phenyl]phenyl]-7-phenylphenanthro[9,10-c]pyridine |
|---|---|
| PubChem CID | 165148441 |
| Molecular Formula | C69H53N3O2 |
| Molecular Weight | 956.20 g/mol |
| Exact Mass | 955.41 |
| IUPAC Name | 3-[4-[2-[3,5-bis[2-(4-pyridin-2-ylphenoxy)propan-2-yl]phenyl]phenyl]phenyl]-7-phenylphenanthro[9,10-c]pyridine |
| SMILES | CC(C)(Oc1ccc(-c2ccccn2)cc1)c1cc(-c2ccccc2-c2ccc(-c3cc4c5ccc(-c6ccccc6)cc5c5ccccc5c4cn3)cc2)cc(C(C)(C)Oc2ccc(-c3ccccn3)cc2)c1 |
| InChI | InChI=1S/C69H53N3O2/c1-68(2,73-55-33-28-48(29-34-55)65-22-12-14-38-70-65)53-40-52(41-54(43-53)69(3,4)74-56-35-30-49(31-36-56)66-23-13-15-39-71-66)58-19-9-8-18-57(58)47-24-26-50(27-25-47)67-44-63-61-37-32-51(46-16-6-5-7-17-46)42-62(61)59-20-10-11-21-60(59)64(63)45-72-67/h5-45H,1-4H3 |
| InChIKey | YPBFFWYLMBCEIK-UHFFFAOYSA-N |
| XLogP | 17.96 |
| TPSA | 57.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 956.20 |
| LogP ≤ 5 | 17.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|