C36H33BF4N4O2 — CID 165148684
3-[5-[2-[3-[2-[6-(2,6-difluoro-3-pyridinyl)-3-pyridinyl]ethyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]-2-pyridinyl]-2,6-difluoropyridine (PubChem CID 165148684) has the molecular formula C36H33BF4N4O2 and a molecular weight of 640.49 g/mol. Its IUPAC name is 3-[5-[2-[3-[2-[6-(2,6-difluoro-3-pyridinyl)-3-pyridinyl]ethyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]-2-pyridinyl]-2,6-difluoropyridine.
| Compound Name | 3-[5-[2-[3-[2-[6-(2,6-difluoro-3-pyridinyl)-3-pyridinyl]ethyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]-2-pyridinyl]-2,6-difluoropyridine |
|---|---|
| PubChem CID | 165148684 |
| Molecular Formula | C36H33BF4N4O2 |
| Molecular Weight | 640.49 g/mol |
| Exact Mass | 640.26 |
| IUPAC Name | 3-[5-[2-[3-[2-[6-(2,6-difluoro-3-pyridinyl)-3-pyridinyl]ethyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]-2-pyridinyl]-2,6-difluoropyridine |
| SMILES | CC1(C)OB(c2cc(CCc3ccc(-c4ccc(F)nc4F)nc3)cc(CCc3ccc(-c4ccc(F)nc4F)nc3)c2)OC1(C)C |
| InChI | InChI=1S/C36H33BF4N4O2/c1-35(2)36(3,4)47-37(46-35)26-18-24(7-5-22-9-13-29(42-20-22)27-11-15-31(38)44-33(27)40)17-25(19-26)8-6-23-10-14-30(43-21-23)28-12-16-32(39)45-34(28)41/h9-21H,5-8H2,1-4H3 |
| InChIKey | JEUXWOPCYRXJLL-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 70.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.49 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|