C67H48IrN3 — CID 165148822
2-[4-[2-[3,5-bis[2-(4-pyridin-2-ylbenzene-5-id-1-yl)ethyl]phenyl]phenyl]benzene-6-id-1-yl]-4-[4-(3-phenylphenyl)phenyl]pyridine;iridium(3+) (PubChem CID 165148822) has the molecular formula C67H48IrN3 and a molecular weight of 1087.36 g/mol. Its IUPAC name is 2-[4-[2-[3,5-bis[2-(4-pyridin-2-ylbenzene-5-id-1-yl)ethyl]phenyl]phenyl]benzene-6-id-1-yl]-4-[4-(3-phenylphenyl)phenyl]pyridine;iridium(3+).
| Compound Name | 2-[4-[2-[3,5-bis[2-(4-pyridin-2-ylbenzene-5-id-1-yl)ethyl]phenyl]phenyl]benzene-6-id-1-yl]-4-[4-(3-phenylphenyl)phenyl]pyridine;iridium(3+) |
|---|---|
| PubChem CID | 165148822 |
| Molecular Formula | C67H48IrN3 |
| Molecular Weight | 1087.36 g/mol |
| Exact Mass | 1087.35 |
| IUPAC Name | 2-[4-[2-[3,5-bis[2-(4-pyridin-2-ylbenzene-5-id-1-yl)ethyl]phenyl]phenyl]benzene-6-id-1-yl]-4-[4-(3-phenylphenyl)phenyl]pyridine;iridium(3+) |
| SMILES | [Ir+3].[c-]1cc(CCc2cc(CCc3c[c-]c(-c4ccccn4)cc3)cc(-c3ccccc3-c3c[c-]c(-c4cc(-c5ccc(-c6cccc(-c7ccccc7)c6)cc5)ccn4)cc3)c2)ccc1-c1ccccn1 |
| InChI | InChI=1S/C67H48N3.Ir/c1-2-11-52(12-3-1)59-13-10-14-60(46-59)53-31-33-54(34-32-53)61-39-42-70-67(47-61)58-37-35-55(36-38-58)63-15-4-5-16-64(63)62-44-50(21-19-48-23-27-56(28-24-48)65-17-6-8-40-68-65)43-51(45-62)22-20-49-25-29-57(30-26-49)66-18-7-9-41-69-66;/h1-18,23-27,29,31-37,39-47H,19-22H2;/q-3;+3 |
| InChIKey | JUKJSUUIDKPQNM-UHFFFAOYSA-N |
| XLogP | 16.18 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1087.36 |
| LogP ≤ 5 | 16.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|