C52H40F3N5O3S — CID 165149125
[2-[4-[2-[3,5-bis[2-(2-methylimidazo[2,1-a]isoquinolin-8-yl)ethyl]phenyl]phenyl]phenyl]-4-pyridinyl] trifluoromethanesulfonate (PubChem CID 165149125) has the molecular formula C52H40F3N5O3S and a molecular weight of 871.99 g/mol. Its IUPAC name is [2-[4-[2-[3,5-bis[2-(2-methylimidazo[2,1-a]isoquinolin-8-yl)ethyl]phenyl]phenyl]phenyl]-4-pyridinyl] trifluoromethanesulfonate.
| Compound Name | [2-[4-[2-[3,5-bis[2-(2-methylimidazo[2,1-a]isoquinolin-8-yl)ethyl]phenyl]phenyl]phenyl]-4-pyridinyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 165149125 |
| Molecular Formula | C52H40F3N5O3S |
| Molecular Weight | 871.99 g/mol |
| Exact Mass | 871.28 |
| IUPAC Name | [2-[4-[2-[3,5-bis[2-(2-methylimidazo[2,1-a]isoquinolin-8-yl)ethyl]phenyl]phenyl]phenyl]-4-pyridinyl] trifluoromethanesulfonate |
| SMILES | Cc1cn2ccc3cc(CCc4cc(CCc5ccc6c(ccn7cc(C)nc67)c5)cc(-c5ccccc5-c5ccc(-c6cc(OS(=O)(=O)C(F)(F)F)ccn6)cc5)c4)ccc3c2n1 |
| InChI | InChI=1S/C52H40F3N5O3S/c1-33-31-59-23-20-41-26-35(11-17-47(41)50(59)57-33)7-9-37-25-38(10-8-36-12-18-48-42(27-36)21-24-60-32-34(2)58-51(48)60)29-43(28-37)46-6-4-3-5-45(46)39-13-15-40(16-14-39)49-30-44(19-22-56-49)63-64(61,62)52(53,54)55/h3-6,11-32H,7-10H2,1-2H3 |
| InChIKey | DXCXGVQLYFNIGM-UHFFFAOYSA-N |
| XLogP | 12.10 |
| TPSA | 90.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 871.99 |
| LogP ≤ 5 | 12.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|