C73H67N3 — CID 165149153
5-[2-[3,5-bis[(1R,2S)-1,2-dimethyl-2-(6-phenyl-3-pyridinyl)cyclohexyl]phenyl]phenyl]-2-phenyl-4-(4-phenylphenyl)pyridine (PubChem CID 165149153) has the molecular formula C73H67N3 and a molecular weight of 986.36 g/mol. Its IUPAC name is 5-[2-[3,5-bis[(1R,2S)-1,2-dimethyl-2-(6-phenyl-3-pyridinyl)cyclohexyl]phenyl]phenyl]-2-phenyl-4-(4-phenylphenyl)pyridine.
| Compound Name | 5-[2-[3,5-bis[(1R,2S)-1,2-dimethyl-2-(6-phenyl-3-pyridinyl)cyclohexyl]phenyl]phenyl]-2-phenyl-4-(4-phenylphenyl)pyridine |
|---|---|
| PubChem CID | 165149153 |
| Molecular Formula | C73H67N3 |
| Molecular Weight | 986.36 g/mol |
| Exact Mass | 985.53 |
| IUPAC Name | 5-[2-[3,5-bis[(1R,2S)-1,2-dimethyl-2-(6-phenyl-3-pyridinyl)cyclohexyl]phenyl]phenyl]-2-phenyl-4-(4-phenylphenyl)pyridine |
| SMILES | C[C@]1(c2ccc(-c3ccccc3)nc2)CCCC[C@]1(C)c1cc(-c2ccccc2-c2cnc(-c3ccccc3)cc2-c2ccc(-c3ccccc3)cc2)cc([C@@]2(C)CCCC[C@]2(C)c2ccc(-c3ccccc3)nc2)c1 |
| InChI | InChI=1S/C73H67N3/c1-70(59-37-39-67(74-49-59)55-25-11-6-12-26-55)41-19-21-43-72(70,3)61-45-58(46-62(47-61)73(4)44-22-20-42-71(73,2)60-38-40-68(75-50-60)56-27-13-7-14-28-56)63-31-17-18-32-64(63)66-51-76-69(57-29-15-8-16-30-57)48-65(66)54-35-33-53(34-36-54)52-23-9-5-10-24-52/h5-18,23-40,45-51H,19-22,41-44H2,1-4H3/t70-,71-,72-,73-/m1/s1 |
| InChIKey | XSHSZGQDXYRCAY-JKJSYVCUSA-N |
| XLogP | 19.12 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 986.36 |
| LogP ≤ 5 | 19.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |