About (3S,4R)-3,4-difluoropyrrolidine-1-sulfonyl chloride
(3S,4R)-3,4-difluoropyrrolidine-1-sulfonyl chloride (PubChem CID 165149898) has the molecular formula C4H6ClF2NO2S
and a molecular weight of 205.61 g/mol. Its IUPAC name is (3S,4R)-3,4-difluoropyrrolidine-1-sulfonyl chloride.
Molecular Properties
| Compound Name | (3S,4R)-3,4-difluoropyrrolidine-1-sulfonyl chloride |
| PubChem CID | 165149898 |
| Molecular Formula | C4H6ClF2NO2S |
| Molecular Weight | 205.61 g/mol |
| Exact Mass | 204.98 |
| IUPAC Name | (3S,4R)-3,4-difluoropyrrolidine-1-sulfonyl chloride |
| SMILES | O=S(=O)(Cl)N1C[C@@H](F)[C@@H](F)C1 |
| InChI | InChI=1S/C4H6ClF2NO2S/c5-11(9,10)8-1-3(6)4(7)2-8/h3-4H,1-2H2/t3-,4+ |
| InChIKey | VINGCOJTCGHRHD-ZXZARUISSA-N |
| XLogP | 0.46 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.61 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3S,4R)-3,4-difluoropyrrolidine-1-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,4R)-3,4-difluoropyrrolidine-1-sulfonyl chloride?
The IUPAC name of (3S,4R)-3,4-difluoropyrrolidine-1-sulfonyl chloride (CID 165149898) is (3S,4R)-3,4-difluoropyrrolidine-1-sulfonyl chloride.
What is the SMILES notation for (3S,4R)-3,4-difluoropyrrolidine-1-sulfonyl chloride?
The canonical SMILES for (3S,4R)-3,4-difluoropyrrolidine-1-sulfonyl chloride is O=S(=O)(Cl)N1C[C@@H](F)[C@@H](F)C1.
What is the InChIKey of (3S,4R)-3,4-difluoropyrrolidine-1-sulfonyl chloride?
The InChIKey is VINGCOJTCGHRHD-ZXZARUISSA-N. The full InChI is InChI=1S/C4H6ClF2NO2S/c5-11(9,10)8-1-3(6)4(7)2-8/h3-4H,1-2H2/t3-,4+.
What are the key properties of (3S,4R)-3,4-difluoropyrrolidine-1-sulfonyl chloride?
(3S,4R)-3,4-difluoropyrrolidine-1-sulfonyl chloride has a molecular weight of 205.61 g/mol, XLogP of 0.46, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4R)-3,4-difluoropyrrolidine-1-sulfonyl chloride is sourced from PubChem (CID 165149898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).