C18H21N3O4P- — CID 165150111
2-[1-(4-cyano-5-methoxyisoquinolin-1-yl)piperidin-4-yl]ethyl-hydroxyphosphinate (PubChem CID 165150111) has the molecular formula C18H21N3O4P- and a molecular weight of 374.36 g/mol. Its IUPAC name is 2-[1-(4-cyano-5-methoxyisoquinolin-1-yl)piperidin-4-yl]ethyl-hydroxyphosphinate.
| Compound Name | 2-[1-(4-cyano-5-methoxyisoquinolin-1-yl)piperidin-4-yl]ethyl-hydroxyphosphinate |
|---|---|
| PubChem CID | 165150111 |
| Molecular Formula | C18H21N3O4P- |
| Molecular Weight | 374.36 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | 2-[1-(4-cyano-5-methoxyisoquinolin-1-yl)piperidin-4-yl]ethyl-hydroxyphosphinate |
| SMILES | COc1cccc2c(N3CCC(CCP(=O)([O-])O)CC3)ncc(C#N)c12 |
| InChI | InChI=1S/C18H22N3O4P/c1-25-16-4-2-3-15-17(16)14(11-19)12-20-18(15)21-8-5-13(6-9-21)7-10-26(22,23)24/h2-4,12-13H,5-10H2,1H3,(H2,22,23,24)/p-1 |
| InChIKey | NYYCHFBRNDDZIU-UHFFFAOYSA-M |
| XLogP | 2.27 |
| TPSA | 109.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.36 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|