C40H30N3P — CID 165152031
[6-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-11,11-dimethylbenzo[a]fluoren-9-yl]phosphane (PubChem CID 165152031) has the molecular formula C40H30N3P and a molecular weight of 583.68 g/mol. Its IUPAC name is [6-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-11,11-dimethylbenzo[a]fluoren-9-yl]phosphane.
| Compound Name | [6-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-11,11-dimethylbenzo[a]fluoren-9-yl]phosphane |
|---|---|
| PubChem CID | 165152031 |
| Molecular Formula | C40H30N3P |
| Molecular Weight | 583.68 g/mol |
| Exact Mass | 583.22 |
| IUPAC Name | [6-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-11,11-dimethylbenzo[a]fluoren-9-yl]phosphane |
| SMILES | CC1(C)c2cc(P)ccc2-c2c(-c3ccc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)cc3)cc3ccccc3c21 |
| InChI | InChI=1S/C40H30N3P/c1-40(2)34-24-30(44)21-22-32(34)35-33(23-29-15-9-10-16-31(29)36(35)40)25-17-19-28(20-18-25)39-42-37(26-11-5-3-6-12-26)41-38(43-39)27-13-7-4-8-14-27/h3-24H,44H2,1-2H3 |
| InChIKey | VREKJWAWNLECIE-UHFFFAOYSA-N |
| XLogP | 9.50 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.68 |
| LogP ≤ 5 | 9.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|