C22H30N6O3S — CID 165152611
N-[2-[6-[(5-cyclobutyl-1,3-thiazol-2-yl)amino]-2-ethylpyrimidin-4-yl]oxyethyl]-2-[methyl(prop-2-enoyl)amino]propanamide (PubChem CID 165152611) has the molecular formula C22H30N6O3S and a molecular weight of 458.59 g/mol. Its IUPAC name is N-[2-[6-[(5-cyclobutyl-1,3-thiazol-2-yl)amino]-2-ethylpyrimidin-4-yl]oxyethyl]-2-[methyl(prop-2-enoyl)amino]propanamide.
| Compound Name | N-[2-[6-[(5-cyclobutyl-1,3-thiazol-2-yl)amino]-2-ethylpyrimidin-4-yl]oxyethyl]-2-[methyl(prop-2-enoyl)amino]propanamide |
|---|---|
| PubChem CID | 165152611 |
| Molecular Formula | C22H30N6O3S |
| Molecular Weight | 458.59 g/mol |
| Exact Mass | 458.21 |
| IUPAC Name | N-[2-[6-[(5-cyclobutyl-1,3-thiazol-2-yl)amino]-2-ethylpyrimidin-4-yl]oxyethyl]-2-[methyl(prop-2-enoyl)amino]propanamide |
| SMILES | C=CC(=O)N(C)C(C)C(=O)NCCOc1cc(Nc2ncc(C3CCC3)s2)nc(CC)n1 |
| InChI | InChI=1S/C22H30N6O3S/c1-5-17-25-18(27-22-24-13-16(32-22)15-8-7-9-15)12-19(26-17)31-11-10-23-21(30)14(3)28(4)20(29)6-2/h6,12-15H,2,5,7-11H2,1,3-4H3,(H,23,30)(H,24,25,26,27) |
| InChIKey | XSVIELLXYCBDRP-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 109.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.59 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|