C17H16F11NO2Si — CID 165154368
N-[3-[ethenyl(dimethyl)silyl]phenyl]-2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)-N-methylpropanamide (PubChem CID 165154368) has the molecular formula C17H16F11NO2Si and a molecular weight of 503.38 g/mol. Its IUPAC name is N-[3-[ethenyl(dimethyl)silyl]phenyl]-2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)-N-methylpropanamide.
| Compound Name | N-[3-[ethenyl(dimethyl)silyl]phenyl]-2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)-N-methylpropanamide |
|---|---|
| PubChem CID | 165154368 |
| Molecular Formula | C17H16F11NO2Si |
| Molecular Weight | 503.38 g/mol |
| Exact Mass | 503.08 |
| IUPAC Name | N-[3-[ethenyl(dimethyl)silyl]phenyl]-2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)-N-methylpropanamide |
| SMILES | C=C[Si](C)(C)c1cccc(N(C)C(=O)C(F)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F)c1 |
| InChI | InChI=1S/C17H16F11NO2Si/c1-5-32(3,4)11-8-6-7-10(9-11)29(2)12(30)13(18,15(21,22)23)31-17(27,28)14(19,20)16(24,25)26/h5-9H,1H2,2-4H3 |
| InChIKey | YVCMGHYQURWXBV-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.38 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|