C16H13NO2 — CID 165155590
N,N-dihydroxy-4-phenylnaphthalen-1-amine (PubChem CID 165155590) has the molecular formula C16H13NO2 and a molecular weight of 251.29 g/mol. Its IUPAC name is N,N-dihydroxy-4-phenylnaphthalen-1-amine.
| Compound Name | N,N-dihydroxy-4-phenylnaphthalen-1-amine |
|---|---|
| PubChem CID | 165155590 |
| Molecular Formula | C16H13NO2 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | N,N-dihydroxy-4-phenylnaphthalen-1-amine |
| SMILES | ON(O)c1ccc(-c2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C16H13NO2/c18-17(19)16-11-10-13(12-6-2-1-3-7-12)14-8-4-5-9-15(14)16/h1-11,18-19H |
| InChIKey | IFALTACQQKDVGV-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|