C30H37F2N9O3S — CID 165155600
N-[3-(3,6-difluoro-2-pyridinyl)-1-(4-ethoxycyclohexyl)pyrazol-4-yl]-2-[1-[3-[ethyl(methyl)amino]propylcarbamoyl]pyrazol-4-yl]-1,3-thiazole-4-carboxamide (PubChem CID 165155600) has the molecular formula C30H37F2N9O3S and a molecular weight of 641.75 g/mol. Its IUPAC name is N-[3-(3,6-difluoro-2-pyridinyl)-1-(4-ethoxycyclohexyl)pyrazol-4-yl]-2-[1-[3-[ethyl(methyl)amino]propylcarbamoyl]pyrazol-4-yl]-1,3-thiazole-4-carboxamide.
| Compound Name | N-[3-(3,6-difluoro-2-pyridinyl)-1-(4-ethoxycyclohexyl)pyrazol-4-yl]-2-[1-[3-[ethyl(methyl)amino]propylcarbamoyl]pyrazol-4-yl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 165155600 |
| Molecular Formula | C30H37F2N9O3S |
| Molecular Weight | 641.75 g/mol |
| Exact Mass | 641.27 |
| IUPAC Name | N-[3-(3,6-difluoro-2-pyridinyl)-1-(4-ethoxycyclohexyl)pyrazol-4-yl]-2-[1-[3-[ethyl(methyl)amino]propylcarbamoyl]pyrazol-4-yl]-1,3-thiazole-4-carboxamide |
| SMILES | CCOC1CCC(n2cc(NC(=O)c3csc(-c4cnn(C(=O)NCCCN(C)CC)c4)n3)c(-c3nc(F)ccc3F)n2)CC1 |
| InChI | InChI=1S/C30H37F2N9O3S/c1-4-39(3)14-6-13-33-30(43)41-16-19(15-34-41)29-36-24(18-45-29)28(42)35-23-17-40(20-7-9-21(10-8-20)44-5-2)38-27(23)26-22(31)11-12-25(32)37-26/h11-12,15-18,20-21H,4-10,13-14H2,1-3H3,(H,33,43)(H,35,42) |
| InChIKey | NCGBMFWSRFAADL-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 132.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.75 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|