C12H4Br3ClN2O — CID 165155817
2,4,8-tribromo-3-chlorophenazin-1-ol (PubChem CID 165155817) has the molecular formula C12H4Br3ClN2O and a molecular weight of 467.34 g/mol. Its IUPAC name is 2,4,8-tribromo-3-chlorophenazin-1-ol.
| Compound Name | 2,4,8-tribromo-3-chlorophenazin-1-ol |
|---|---|
| PubChem CID | 165155817 |
| Molecular Formula | C12H4Br3ClN2O |
| Molecular Weight | 467.34 g/mol |
| Exact Mass | 463.76 |
| IUPAC Name | 2,4,8-tribromo-3-chlorophenazin-1-ol |
| SMILES | Oc1c(Br)c(Cl)c(Br)c2nc3ccc(Br)cc3nc12 |
| InChI | InChI=1S/C12H4Br3ClN2O/c13-4-1-2-5-6(3-4)18-11-10(17-5)7(14)9(16)8(15)12(11)19/h1-3,19H |
| InChIKey | FYAAZCSFMMFALN-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.34 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|