About CID 165155960
CID 165155960 (PubChem CID 165155960) has the molecular formula C6H6N4O2
and a molecular weight of 166.14 g/mol.
Molecular Properties
| Compound Name | CID 165155960 |
| PubChem CID | 165155960 |
| Molecular Formula | C6H6N4O2 |
| Molecular Weight | 166.14 g/mol |
| Exact Mass | 166.05 |
| IUPAC Name | — |
| SMILES | [CH]C(=O)COCc1nnn([CH])n1 |
| InChI | InChI=1S/C6H6N4O2/c1-5(11)3-12-4-6-7-9-10(2)8-6/h1-2H,3-4H2 |
| InChIKey | NPFCVZNSDGNVOU-UHFFFAOYSA-N |
| XLogP | -1.01 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.14 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze CID 165155960 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 165155960?
The IUPAC name of CID 165155960 (CID 165155960) is not available.
What is the SMILES notation for CID 165155960?
The canonical SMILES for CID 165155960 is [CH]C(=O)COCc1nnn([CH])n1.
What is the InChIKey of CID 165155960?
The InChIKey is NPFCVZNSDGNVOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N4O2/c1-5(11)3-12-4-6-7-9-10(2)8-6/h1-2H,3-4H2.
What are the key properties of CID 165155960?
CID 165155960 has a molecular weight of 166.14 g/mol, XLogP of -1.01, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 165155960 is sourced from PubChem (CID 165155960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).