C17H13F4O7STe- — CID 165156272
1,1,2,2-tetrafluoro-5-[2-hydroxy-4-(4-hydroxyphenyl)tellanylphenoxy]-5-oxopentane-1-sulfonate (PubChem CID 165156272) has the molecular formula C17H13F4O7STe- and a molecular weight of 564.94 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-5-[2-hydroxy-4-(4-hydroxyphenyl)tellanylphenoxy]-5-oxopentane-1-sulfonate.
| Compound Name | 1,1,2,2-tetrafluoro-5-[2-hydroxy-4-(4-hydroxyphenyl)tellanylphenoxy]-5-oxopentane-1-sulfonate |
|---|---|
| PubChem CID | 165156272 |
| Molecular Formula | C17H13F4O7STe- |
| Molecular Weight | 564.94 g/mol |
| Exact Mass | 566.94 |
| IUPAC Name | 1,1,2,2-tetrafluoro-5-[2-hydroxy-4-(4-hydroxyphenyl)tellanylphenoxy]-5-oxopentane-1-sulfonate |
| SMILES | O=C(CCC(F)(F)C(F)(F)S(=O)(=O)[O-])Oc1ccc([Te]c2ccc(O)cc2)cc1O |
| InChI | InChI=1S/C17H14F4O7STe/c18-16(19,17(20,21)29(25,26)27)8-7-15(24)28-14-6-5-12(9-13(14)23)30-11-3-1-10(22)2-4-11/h1-6,9,22-23H,7-8H2,(H,25,26,27)/p-1 |
| InChIKey | OCOIMCLHENLWIO-UHFFFAOYSA-M |
| XLogP | 1.21 |
| TPSA | 123.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.94 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|