C25H37BFN5O2Si — CID 165156431
N-[(3S)-1-[3-(6-fluoro-3-pyridinyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]piperidin-3-yl]-N-dimethylboronamidic acid (PubChem CID 165156431) has the molecular formula C25H37BFN5O2Si and a molecular weight of 497.50 g/mol. Its IUPAC name is N-[(3S)-1-[3-(6-fluoro-3-pyridinyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]piperidin-3-yl]-N-dimethylboronamidic acid.
| Compound Name | N-[(3S)-1-[3-(6-fluoro-3-pyridinyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]piperidin-3-yl]-N-dimethylboronamidic acid |
|---|---|
| PubChem CID | 165156431 |
| Molecular Formula | C25H37BFN5O2Si |
| Molecular Weight | 497.50 g/mol |
| Exact Mass | 497.28 |
| IUPAC Name | N-[(3S)-1-[3-(6-fluoro-3-pyridinyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]piperidin-3-yl]-N-dimethylboronamidic acid |
| SMILES | CB(O)N(C)[C@H]1CCCN(c2ccnc3c2c(-c2ccc(F)nc2)cn3COCC[Si](C)(C)C)C1 |
| InChI | InChI=1S/C25H37BFN5O2Si/c1-26(33)30(2)20-7-6-12-31(16-20)22-10-11-28-25-24(22)21(19-8-9-23(27)29-15-19)17-32(25)18-34-13-14-35(3,4)5/h8-11,15,17,20,33H,6-7,12-14,16,18H2,1-5H3/t20-/m0/s1 |
| InChIKey | OJUZWDOCRZTCAS-FQEVSTJZSA-N |
| XLogP | 4.56 |
| TPSA | 66.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.50 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|