About (4-chloro-1H-pyrrolo[2,3-b]pyridine-3-carboximidoyl)oxymethanethioic S-acid
(4-chloro-1H-pyrrolo[2,3-b]pyridine-3-carboximidoyl)oxymethanethioic S-acid (PubChem CID 165156645) has the molecular formula C9H6ClN3O2S
and a molecular weight of 255.69 g/mol. Its IUPAC name is (4-chloro-1H-pyrrolo[2,3-b]pyridine-3-carboximidoyl)oxymethanethioic S-acid.
Molecular Properties
| Compound Name | (4-chloro-1H-pyrrolo[2,3-b]pyridine-3-carboximidoyl)oxymethanethioic S-acid |
| PubChem CID | 165156645 |
| Molecular Formula | C9H6ClN3O2S |
| Molecular Weight | 255.69 g/mol |
| Exact Mass | 254.99 |
| IUPAC Name | (4-chloro-1H-pyrrolo[2,3-b]pyridine-3-carboximidoyl)oxymethanethioic S-acid |
| SMILES | [H]/N=C(\OC(=O)S)c1c[nH]c2nccc(Cl)c12 |
| InChI | InChI=1S/C9H6ClN3O2S/c10-5-1-2-12-8-6(5)4(3-13-8)7(11)15-9(14)16/h1-3,11H,(H,12,13)(H,14,16)/b11-7- |
| InChIKey | JQSRHAZVNYORJB-XFFZJAGNSA-N |
| XLogP | 2.61 |
| TPSA | 78.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.69 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (4-chloro-1H-pyrrolo[2,3-b]pyridine-3-carboximidoyl)oxymethanethioic S-acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-chloro-1H-pyrrolo[2,3-b]pyridine-3-carboximidoyl)oxymethanethioic S-acid?
The IUPAC name of (4-chloro-1H-pyrrolo[2,3-b]pyridine-3-carboximidoyl)oxymethanethioic S-acid (CID 165156645) is (4-chloro-1H-pyrrolo[2,3-b]pyridine-3-carboximidoyl)oxymethanethioic S-acid.
What is the SMILES notation for (4-chloro-1H-pyrrolo[2,3-b]pyridine-3-carboximidoyl)oxymethanethioic S-acid?
The canonical SMILES for (4-chloro-1H-pyrrolo[2,3-b]pyridine-3-carboximidoyl)oxymethanethioic S-acid is [H]/N=C(\OC(=O)S)c1c[nH]c2nccc(Cl)c12.
What is the InChIKey of (4-chloro-1H-pyrrolo[2,3-b]pyridine-3-carboximidoyl)oxymethanethioic S-acid?
The InChIKey is JQSRHAZVNYORJB-XFFZJAGNSA-N. The full InChI is InChI=1S/C9H6ClN3O2S/c10-5-1-2-12-8-6(5)4(3-13-8)7(11)15-9(14)16/h1-3,11H,(H,12,13)(H,14,16)/b11-7-.
What are the key properties of (4-chloro-1H-pyrrolo[2,3-b]pyridine-3-carboximidoyl)oxymethanethioic S-acid?
(4-chloro-1H-pyrrolo[2,3-b]pyridine-3-carboximidoyl)oxymethanethioic S-acid has a molecular weight of 255.69 g/mol, XLogP of 2.61, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chloro-1H-pyrrolo[2,3-b]pyridine-3-carboximidoyl)oxymethanethioic S-acid is sourced from PubChem (CID 165156645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).