C19H25N7 — CID 165156646
N-methyl-N'-[1-(3-pyrimidin-5-yl-1H-pyrrolo[2,3-b]pyridin-4-yl)piperidin-3-yl]ethane-1,2-diamine (PubChem CID 165156646) has the molecular formula C19H25N7 and a molecular weight of 351.46 g/mol. Its IUPAC name is N-methyl-N'-[1-(3-pyrimidin-5-yl-1H-pyrrolo[2,3-b]pyridin-4-yl)piperidin-3-yl]ethane-1,2-diamine.
| Compound Name | N-methyl-N'-[1-(3-pyrimidin-5-yl-1H-pyrrolo[2,3-b]pyridin-4-yl)piperidin-3-yl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 165156646 |
| Molecular Formula | C19H25N7 |
| Molecular Weight | 351.46 g/mol |
| Exact Mass | 351.22 |
| IUPAC Name | N-methyl-N'-[1-(3-pyrimidin-5-yl-1H-pyrrolo[2,3-b]pyridin-4-yl)piperidin-3-yl]ethane-1,2-diamine |
| SMILES | CNCCNC1CCCN(c2ccnc3[nH]cc(-c4cncnc4)c23)C1 |
| InChI | InChI=1S/C19H25N7/c1-20-6-7-23-15-3-2-8-26(12-15)17-4-5-24-19-18(17)16(11-25-19)14-9-21-13-22-10-14/h4-5,9-11,13,15,20,23H,2-3,6-8,12H2,1H3,(H,24,25) |
| InChIKey | YMYQDEDOYYQJLG-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 81.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.46 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|