C26H37FN6OSi — CID 165156716
2-[[4-[(3S)-3-(3-fluoropyrrolidin-1-yl)piperidin-1-yl]-3-pyrimidin-5-ylpyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 165156716) has the molecular formula C26H37FN6OSi and a molecular weight of 496.71 g/mol. Its IUPAC name is 2-[[4-[(3S)-3-(3-fluoropyrrolidin-1-yl)piperidin-1-yl]-3-pyrimidin-5-ylpyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[4-[(3S)-3-(3-fluoropyrrolidin-1-yl)piperidin-1-yl]-3-pyrimidin-5-ylpyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 165156716 |
| Molecular Formula | C26H37FN6OSi |
| Molecular Weight | 496.71 g/mol |
| Exact Mass | 496.28 |
| IUPAC Name | 2-[[4-[(3S)-3-(3-fluoropyrrolidin-1-yl)piperidin-1-yl]-3-pyrimidin-5-ylpyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1cc(-c2cncnc2)c2c(N3CCC[C@H](N4CCC(F)C4)C3)ccnc21 |
| InChI | InChI=1S/C26H37FN6OSi/c1-35(2,3)12-11-34-19-33-17-23(20-13-28-18-29-14-20)25-24(6-8-30-26(25)33)32-9-4-5-22(16-32)31-10-7-21(27)15-31/h6,8,13-14,17-18,21-22H,4-5,7,9-12,15-16,19H2,1-3H3/t21?,22-/m0/s1 |
| InChIKey | VMWISFIYKIZMKN-KEKNWZKVSA-N |
| XLogP | 4.82 |
| TPSA | 59.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.71 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|