C13H26N2O2 — CID 165156817
N-[3,3-dimethyl-1-(methylamino)butan-2-yl]-N,3-dimethyl-2-oxobutanamide (PubChem CID 165156817) has the molecular formula C13H26N2O2 and a molecular weight of 242.36 g/mol. Its IUPAC name is N-[3,3-dimethyl-1-(methylamino)butan-2-yl]-N,3-dimethyl-2-oxobutanamide.
| Compound Name | N-[3,3-dimethyl-1-(methylamino)butan-2-yl]-N,3-dimethyl-2-oxobutanamide |
|---|---|
| PubChem CID | 165156817 |
| Molecular Formula | C13H26N2O2 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | N-[3,3-dimethyl-1-(methylamino)butan-2-yl]-N,3-dimethyl-2-oxobutanamide |
| SMILES | CNCC(N(C)C(=O)C(=O)C(C)C)C(C)(C)C |
| InChI | InChI=1S/C13H26N2O2/c1-9(2)11(16)12(17)15(7)10(8-14-6)13(3,4)5/h9-10,14H,8H2,1-7H3 |
| InChIKey | YMZSJAKECVLORG-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|