About N-[5-[(3,4-difluorocyclohexyl)methyl]piperidin-2-yl]-1-methylpyrazolidine-3-carboxamide
N-[5-[(3,4-difluorocyclohexyl)methyl]piperidin-2-yl]-1-methylpyrazolidine-3-carboxamide (PubChem CID 165157012) has the molecular formula C17H30F2N4O
and a molecular weight of 344.45 g/mol. Its IUPAC name is N-[5-[(3,4-difluorocyclohexyl)methyl]piperidin-2-yl]-1-methylpyrazolidine-3-carboxamide.
Molecular Properties
| Compound Name | N-[5-[(3,4-difluorocyclohexyl)methyl]piperidin-2-yl]-1-methylpyrazolidine-3-carboxamide |
| PubChem CID | 165157012 |
| Molecular Formula | C17H30F2N4O |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.24 |
| IUPAC Name | N-[5-[(3,4-difluorocyclohexyl)methyl]piperidin-2-yl]-1-methylpyrazolidine-3-carboxamide |
| SMILES | CN1CCC(C(=O)NC2CCC(CC3CCC(F)C(F)C3)CN2)N1 |
| InChI | InChI=1S/C17H30F2N4O/c1-23-7-6-15(22-23)17(24)21-16-5-3-12(10-20-16)8-11-2-4-13(18)14(19)9-11/h11-16,20,22H,2-10H2,1H3,(H,21,24) |
| InChIKey | MEAKOESOGVNQQE-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 56.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[5-[(3,4-difluorocyclohexyl)methyl]piperidin-2-yl]-1-methylpyrazolidine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[5-[(3,4-difluorocyclohexyl)methyl]piperidin-2-yl]-1-methylpyrazolidine-3-carboxamide?
The IUPAC name of N-[5-[(3,4-difluorocyclohexyl)methyl]piperidin-2-yl]-1-methylpyrazolidine-3-carboxamide (CID 165157012) is N-[5-[(3,4-difluorocyclohexyl)methyl]piperidin-2-yl]-1-methylpyrazolidine-3-carboxamide.
What is the SMILES notation for N-[5-[(3,4-difluorocyclohexyl)methyl]piperidin-2-yl]-1-methylpyrazolidine-3-carboxamide?
The canonical SMILES for N-[5-[(3,4-difluorocyclohexyl)methyl]piperidin-2-yl]-1-methylpyrazolidine-3-carboxamide is CN1CCC(C(=O)NC2CCC(CC3CCC(F)C(F)C3)CN2)N1.
What is the InChIKey of N-[5-[(3,4-difluorocyclohexyl)methyl]piperidin-2-yl]-1-methylpyrazolidine-3-carboxamide?
The InChIKey is MEAKOESOGVNQQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H30F2N4O/c1-23-7-6-15(22-23)17(24)21-16-5-3-12(10-20-16)8-11-2-4-13(18)14(19)9-11/h11-16,20,22H,2-10H2,1H3,(H,21,24).
What are the key properties of N-[5-[(3,4-difluorocyclohexyl)methyl]piperidin-2-yl]-1-methylpyrazolidine-3-carboxamide?
N-[5-[(3,4-difluorocyclohexyl)methyl]piperidin-2-yl]-1-methylpyrazolidine-3-carboxamide has a molecular weight of 344.45 g/mol, XLogP of 1.50, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[5-[(3,4-difluorocyclohexyl)methyl]piperidin-2-yl]-1-methylpyrazolidine-3-carboxamide is sourced from PubChem (CID 165157012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).