About N-[5-[(3,4-difluorocyclohexyl)methyl]piperidin-2-yl]-6-methyldiazinane-3-carboxamide
N-[5-[(3,4-difluorocyclohexyl)methyl]piperidin-2-yl]-6-methyldiazinane-3-carboxamide (PubChem CID 165157046) has the molecular formula C18H32F2N4O
and a molecular weight of 358.48 g/mol. Its IUPAC name is N-[5-[(3,4-difluorocyclohexyl)methyl]piperidin-2-yl]-6-methyldiazinane-3-carboxamide.
Molecular Properties
| Compound Name | N-[5-[(3,4-difluorocyclohexyl)methyl]piperidin-2-yl]-6-methyldiazinane-3-carboxamide |
| PubChem CID | 165157046 |
| Molecular Formula | C18H32F2N4O |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.25 |
| IUPAC Name | N-[5-[(3,4-difluorocyclohexyl)methyl]piperidin-2-yl]-6-methyldiazinane-3-carboxamide |
| SMILES | CC1CCC(C(=O)NC2CCC(CC3CCC(F)C(F)C3)CN2)NN1 |
| InChI | InChI=1S/C18H32F2N4O/c1-11-2-6-16(24-23-11)18(25)22-17-7-4-13(10-21-17)8-12-3-5-14(19)15(20)9-12/h11-17,21,23-24H,2-10H2,1H3,(H,22,25) |
| InChIKey | BHPQBCMEXNZDCM-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 65.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[5-[(3,4-difluorocyclohexyl)methyl]piperidin-2-yl]-6-methyldiazinane-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[5-[(3,4-difluorocyclohexyl)methyl]piperidin-2-yl]-6-methyldiazinane-3-carboxamide?
The IUPAC name of N-[5-[(3,4-difluorocyclohexyl)methyl]piperidin-2-yl]-6-methyldiazinane-3-carboxamide (CID 165157046) is N-[5-[(3,4-difluorocyclohexyl)methyl]piperidin-2-yl]-6-methyldiazinane-3-carboxamide.
What is the SMILES notation for N-[5-[(3,4-difluorocyclohexyl)methyl]piperidin-2-yl]-6-methyldiazinane-3-carboxamide?
The canonical SMILES for N-[5-[(3,4-difluorocyclohexyl)methyl]piperidin-2-yl]-6-methyldiazinane-3-carboxamide is CC1CCC(C(=O)NC2CCC(CC3CCC(F)C(F)C3)CN2)NN1.
What is the InChIKey of N-[5-[(3,4-difluorocyclohexyl)methyl]piperidin-2-yl]-6-methyldiazinane-3-carboxamide?
The InChIKey is BHPQBCMEXNZDCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H32F2N4O/c1-11-2-6-16(24-23-11)18(25)22-17-7-4-13(10-21-17)8-12-3-5-14(19)15(20)9-12/h11-17,21,23-24H,2-10H2,1H3,(H,22,25).
What are the key properties of N-[5-[(3,4-difluorocyclohexyl)methyl]piperidin-2-yl]-6-methyldiazinane-3-carboxamide?
N-[5-[(3,4-difluorocyclohexyl)methyl]piperidin-2-yl]-6-methyldiazinane-3-carboxamide has a molecular weight of 358.48 g/mol, XLogP of 1.94, 4 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[5-[(3,4-difluorocyclohexyl)methyl]piperidin-2-yl]-6-methyldiazinane-3-carboxamide is sourced from PubChem (CID 165157046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).