C19H32ClN3O2 — CID 165157058
4-[(3-chlorocyclohexyl)methyl]-N-(1-methyl-6-oxopiperidin-3-yl)piperidine-1-carboxamide (PubChem CID 165157058) has the molecular formula C19H32ClN3O2 and a molecular weight of 369.94 g/mol. Its IUPAC name is 4-[(3-chlorocyclohexyl)methyl]-N-(1-methyl-6-oxopiperidin-3-yl)piperidine-1-carboxamide.
| Compound Name | 4-[(3-chlorocyclohexyl)methyl]-N-(1-methyl-6-oxopiperidin-3-yl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 165157058 |
| Molecular Formula | C19H32ClN3O2 |
| Molecular Weight | 369.94 g/mol |
| Exact Mass | 369.22 |
| IUPAC Name | 4-[(3-chlorocyclohexyl)methyl]-N-(1-methyl-6-oxopiperidin-3-yl)piperidine-1-carboxamide |
| SMILES | CN1CC(NC(=O)N2CCC(CC3CCCC(Cl)C3)CC2)CCC1=O |
| InChI | InChI=1S/C19H32ClN3O2/c1-22-13-17(5-6-18(22)24)21-19(25)23-9-7-14(8-10-23)11-15-3-2-4-16(20)12-15/h14-17H,2-13H2,1H3,(H,21,25) |
| InChIKey | IDAFGXNJTKNZDE-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.94 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|