C27H29NO6 — CID 165157177
[4-[1-anilino-2-(4-propan-2-yloxyphenyl)ethyl]-3-(formyloxymethyl)-7-oxabicyclo[2.2.1]hepta-2,5-dien-2-yl]methyl formate (PubChem CID 165157177) has the molecular formula C27H29NO6 and a molecular weight of 463.53 g/mol. Its IUPAC name is [4-[1-anilino-2-(4-propan-2-yloxyphenyl)ethyl]-3-(formyloxymethyl)-7-oxabicyclo[2.2.1]hepta-2,5-dien-2-yl]methyl formate.
| Compound Name | [4-[1-anilino-2-(4-propan-2-yloxyphenyl)ethyl]-3-(formyloxymethyl)-7-oxabicyclo[2.2.1]hepta-2,5-dien-2-yl]methyl formate |
|---|---|
| PubChem CID | 165157177 |
| Molecular Formula | C27H29NO6 |
| Molecular Weight | 463.53 g/mol |
| Exact Mass | 463.20 |
| IUPAC Name | [4-[1-anilino-2-(4-propan-2-yloxyphenyl)ethyl]-3-(formyloxymethyl)-7-oxabicyclo[2.2.1]hepta-2,5-dien-2-yl]methyl formate |
| SMILES | CC(C)Oc1ccc(CC(Nc2ccccc2)C23C=CC(O2)C(COC=O)=C3COC=O)cc1 |
| InChI | InChI=1S/C27H29NO6/c1-19(2)33-22-10-8-20(9-11-22)14-26(28-21-6-4-3-5-7-21)27-13-12-25(34-27)23(15-31-17-29)24(27)16-32-18-30/h3-13,17-19,25-26,28H,14-16H2,1-2H3 |
| InChIKey | UJONHFXKSPYCLY-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.53 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|