C15H26N3O8PS — CID 165157398
[(2R)-2-aminopentyl] [dideuterio-[(2R,3S,5R)-3,4-dihydroxy-4-methyl-5-(4-oxo-2-sulfanylidenepyrimidin-1-yl)oxolan-2-yl]methyl] hydrogen phosphate (PubChem CID 165157398) has the molecular formula C15H26N3O8PS and a molecular weight of 441.44 g/mol. Its IUPAC name is [(2R)-2-aminopentyl] [dideuterio-[(2R,3S,5R)-3,4-dihydroxy-4-methyl-5-(4-oxo-2-sulfanylidenepyrimidin-1-yl)oxolan-2-yl]methyl] hydrogen phosphate.
| Compound Name | [(2R)-2-aminopentyl] [dideuterio-[(2R,3S,5R)-3,4-dihydroxy-4-methyl-5-(4-oxo-2-sulfanylidenepyrimidin-1-yl)oxolan-2-yl]methyl] hydrogen phosphate |
|---|---|
| PubChem CID | 165157398 |
| Molecular Formula | C15H26N3O8PS |
| Molecular Weight | 441.44 g/mol |
| Exact Mass | 441.13 |
| IUPAC Name | [(2R)-2-aminopentyl] [dideuterio-[(2R,3S,5R)-3,4-dihydroxy-4-methyl-5-(4-oxo-2-sulfanylidenepyrimidin-1-yl)oxolan-2-yl]methyl] hydrogen phosphate |
| SMILES | [2H]C([2H])(OP(=O)(O)OC[C@H](N)CCC)[C@H]1O[C@@H](n2ccc(=O)[nH]c2=S)C(C)(O)[C@H]1O |
| InChI | InChI=1S/C15H26N3O8PS/c1-3-4-9(16)7-24-27(22,23)25-8-10-12(20)15(2,21)13(26-10)18-6-5-11(19)17-14(18)28/h5-6,9-10,12-13,20-21H,3-4,7-8,16H2,1-2H3,(H,22,23)(H,17,19,28)/t9-,10-,12+,13-,15?/m1/s1/i8D2 |
| InChIKey | AZWORNRZQSRJSX-QDJYQDQPSA-N |
| XLogP | 0.18 |
| TPSA | 169.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.44 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|