About 3-fluoro-1H-pyrimidine-2,4-dithione
3-fluoro-1H-pyrimidine-2,4-dithione (PubChem CID 165157405) has the molecular formula C4H3FN2S2
and a molecular weight of 162.21 g/mol. Its IUPAC name is 3-fluoro-1H-pyrimidine-2,4-dithione.
Molecular Properties
| Compound Name | 3-fluoro-1H-pyrimidine-2,4-dithione |
| PubChem CID | 165157405 |
| Molecular Formula | C4H3FN2S2 |
| Molecular Weight | 162.21 g/mol |
| Exact Mass | 161.97 |
| IUPAC Name | 3-fluoro-1H-pyrimidine-2,4-dithione |
| SMILES | Fn1c(=S)cc[nH]c1=S |
| InChI | InChI=1S/C4H3FN2S2/c5-7-3(8)1-2-6-4(7)9/h1-2H,(H,6,9) |
| InChIKey | UUWSCNMXOHTGTM-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.21 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-fluoro-1H-pyrimidine-2,4-dithione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-1H-pyrimidine-2,4-dithione?
The IUPAC name of 3-fluoro-1H-pyrimidine-2,4-dithione (CID 165157405) is 3-fluoro-1H-pyrimidine-2,4-dithione.
What is the SMILES notation for 3-fluoro-1H-pyrimidine-2,4-dithione?
The canonical SMILES for 3-fluoro-1H-pyrimidine-2,4-dithione is Fn1c(=S)cc[nH]c1=S.
What is the InChIKey of 3-fluoro-1H-pyrimidine-2,4-dithione?
The InChIKey is UUWSCNMXOHTGTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H3FN2S2/c5-7-3(8)1-2-6-4(7)9/h1-2H,(H,6,9).
What are the key properties of 3-fluoro-1H-pyrimidine-2,4-dithione?
3-fluoro-1H-pyrimidine-2,4-dithione has a molecular weight of 162.21 g/mol, XLogP of 2.01, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-1H-pyrimidine-2,4-dithione is sourced from PubChem (CID 165157405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).