C13H25BN2O4S — CID 165158087
(E)-1-methylsulfonyl-3-propan-2-ylimino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-en-1-amine (PubChem CID 165158087) has the molecular formula C13H25BN2O4S and a molecular weight of 316.23 g/mol. Its IUPAC name is (E)-1-methylsulfonyl-3-propan-2-ylimino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-en-1-amine.
| Compound Name | (E)-1-methylsulfonyl-3-propan-2-ylimino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-en-1-amine |
|---|---|
| PubChem CID | 165158087 |
| Molecular Formula | C13H25BN2O4S |
| Molecular Weight | 316.23 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | (E)-1-methylsulfonyl-3-propan-2-ylimino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-en-1-amine |
| SMILES | CC(C)/N=C/C(B1OC(C)(C)C(C)(C)O1)=C(\N)S(C)(=O)=O |
| InChI | InChI=1S/C13H25BN2O4S/c1-9(2)16-8-10(11(15)21(7,17)18)14-19-12(3,4)13(5,6)20-14/h8-9H,15H2,1-7H3/b11-10-,16-8+ |
| InChIKey | POIBEIDDHOYLNV-TZINGHKZSA-N |
| XLogP | 1.31 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.23 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|