C32H31F2N5O3S — CID 165158607
11,13-difluoro-12-(2-hydroxyphenyl)-4-methyl-15-(4-methyl-2-propan-2-yl-3-pyridinyl)-5-prop-2-enoyl-9-thia-2,5,15,17-tetrazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10,12,14(18)-tetraen-16-one (PubChem CID 165158607) has the molecular formula C32H31F2N5O3S and a molecular weight of 603.70 g/mol. Its IUPAC name is 11,13-difluoro-12-(2-hydroxyphenyl)-4-methyl-15-(4-methyl-2-propan-2-yl-3-pyridinyl)-5-prop-2-enoyl-9-thia-2,5,15,17-tetrazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10,12,14(18)-tetraen-16-one.
| Compound Name | 11,13-difluoro-12-(2-hydroxyphenyl)-4-methyl-15-(4-methyl-2-propan-2-yl-3-pyridinyl)-5-prop-2-enoyl-9-thia-2,5,15,17-tetrazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10,12,14(18)-tetraen-16-one |
|---|---|
| PubChem CID | 165158607 |
| Molecular Formula | C32H31F2N5O3S |
| Molecular Weight | 603.70 g/mol |
| Exact Mass | 603.21 |
| IUPAC Name | 11,13-difluoro-12-(2-hydroxyphenyl)-4-methyl-15-(4-methyl-2-propan-2-yl-3-pyridinyl)-5-prop-2-enoyl-9-thia-2,5,15,17-tetrazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10,12,14(18)-tetraen-16-one |
| SMILES | C=CC(=O)N1CC2CSc3c(F)c(-c4ccccc4O)c(F)c4c3c(nc(=O)n4-c3c(C)ccnc3C(C)C)N2CC1C |
| InChI | InChI=1S/C32H31F2N5O3S/c1-6-22(41)37-14-19-15-43-30-24-29(25(33)23(26(30)34)20-9-7-8-10-21(20)40)39(28-17(4)11-12-35-27(28)16(2)3)32(42)36-31(24)38(19)13-18(37)5/h6-12,16,18-19,40H,1,13-15H2,2-5H3 |
| InChIKey | NHWJQLWBPAXTCZ-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.70 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|