C17H22FN5O — CID 165158825
11-fluoro-4,5,12,15-tetramethyl-2,5,9,15,17-pentazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10,12,14(18)-tetraen-16-one (PubChem CID 165158825) has the molecular formula C17H22FN5O and a molecular weight of 331.40 g/mol. Its IUPAC name is 11-fluoro-4,5,12,15-tetramethyl-2,5,9,15,17-pentazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10,12,14(18)-tetraen-16-one.
| Compound Name | 11-fluoro-4,5,12,15-tetramethyl-2,5,9,15,17-pentazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10,12,14(18)-tetraen-16-one |
|---|---|
| PubChem CID | 165158825 |
| Molecular Formula | C17H22FN5O |
| Molecular Weight | 331.40 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | 11-fluoro-4,5,12,15-tetramethyl-2,5,9,15,17-pentazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10,12,14(18)-tetraen-16-one |
| SMILES | Cc1cc2c3c(nc(=O)n2C)N2CC(C)N(C)CC2CNc3c1F |
| InChI | InChI=1S/C17H22FN5O/c1-9-5-12-13-15(14(9)18)19-6-11-8-21(3)10(2)7-23(11)16(13)20-17(24)22(12)4/h5,10-11,19H,6-8H2,1-4H3 |
| InChIKey | OFPPDMHXKGPXRT-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.40 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |