About 1-[(E)-4,4-dimethylpent-2-enyl]piperidine-3-carboxylic acid
1-[(E)-4,4-dimethylpent-2-enyl]piperidine-3-carboxylic acid (PubChem CID 165160276) has the molecular formula C13H23NO2
and a molecular weight of 225.33 g/mol. Its IUPAC name is 1-[(E)-4,4-dimethylpent-2-enyl]piperidine-3-carboxylic acid.
Molecular Properties
| Compound Name | 1-[(E)-4,4-dimethylpent-2-enyl]piperidine-3-carboxylic acid |
| PubChem CID | 165160276 |
| Molecular Formula | C13H23NO2 |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.17 |
| IUPAC Name | 1-[(E)-4,4-dimethylpent-2-enyl]piperidine-3-carboxylic acid |
| SMILES | CC(C)(C)/C=C/CN1CCCC(C(=O)O)C1 |
| InChI | InChI=1S/C13H23NO2/c1-13(2,3)7-5-9-14-8-4-6-11(10-14)12(15)16/h5,7,11H,4,6,8-10H2,1-3H3,(H,15,16)/b7-5+ |
| InChIKey | BYQBQGXUCPAQHR-FNORWQNLSA-N |
| XLogP | 2.39 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(E)-4,4-dimethylpent-2-enyl]piperidine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(E)-4,4-dimethylpent-2-enyl]piperidine-3-carboxylic acid?
The IUPAC name of 1-[(E)-4,4-dimethylpent-2-enyl]piperidine-3-carboxylic acid (CID 165160276) is 1-[(E)-4,4-dimethylpent-2-enyl]piperidine-3-carboxylic acid.
What is the SMILES notation for 1-[(E)-4,4-dimethylpent-2-enyl]piperidine-3-carboxylic acid?
The canonical SMILES for 1-[(E)-4,4-dimethylpent-2-enyl]piperidine-3-carboxylic acid is CC(C)(C)/C=C/CN1CCCC(C(=O)O)C1.
What is the InChIKey of 1-[(E)-4,4-dimethylpent-2-enyl]piperidine-3-carboxylic acid?
The InChIKey is BYQBQGXUCPAQHR-FNORWQNLSA-N. The full InChI is InChI=1S/C13H23NO2/c1-13(2,3)7-5-9-14-8-4-6-11(10-14)12(15)16/h5,7,11H,4,6,8-10H2,1-3H3,(H,15,16)/b7-5+.
What are the key properties of 1-[(E)-4,4-dimethylpent-2-enyl]piperidine-3-carboxylic acid?
1-[(E)-4,4-dimethylpent-2-enyl]piperidine-3-carboxylic acid has a molecular weight of 225.33 g/mol, XLogP of 2.39, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(E)-4,4-dimethylpent-2-enyl]piperidine-3-carboxylic acid is sourced from PubChem (CID 165160276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).