About 1-(5-amino-6-isocyanopyrazin-2-yl)propane-1,2-diol
1-(5-amino-6-isocyanopyrazin-2-yl)propane-1,2-diol (PubChem CID 165160308) has the molecular formula C8H10N4O2
and a molecular weight of 194.19 g/mol. Its IUPAC name is 1-(5-amino-6-isocyanopyrazin-2-yl)propane-1,2-diol.
Molecular Properties
| Compound Name | 1-(5-amino-6-isocyanopyrazin-2-yl)propane-1,2-diol |
| PubChem CID | 165160308 |
| Molecular Formula | C8H10N4O2 |
| Molecular Weight | 194.19 g/mol |
| Exact Mass | 194.08 |
| IUPAC Name | 1-(5-amino-6-isocyanopyrazin-2-yl)propane-1,2-diol |
| SMILES | [C-]#[N+]c1nc(C(O)C(C)O)cnc1N |
| InChI | InChI=1S/C8H10N4O2/c1-4(13)6(14)5-3-11-7(9)8(10-2)12-5/h3-4,6,13-14H,1H3,(H2,9,11) |
| InChIKey | PHAODQGCZCEMRD-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 96.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.19 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1-(5-amino-6-isocyanopyrazin-2-yl)propane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-amino-6-isocyanopyrazin-2-yl)propane-1,2-diol?
The IUPAC name of 1-(5-amino-6-isocyanopyrazin-2-yl)propane-1,2-diol (CID 165160308) is 1-(5-amino-6-isocyanopyrazin-2-yl)propane-1,2-diol.
What is the SMILES notation for 1-(5-amino-6-isocyanopyrazin-2-yl)propane-1,2-diol?
The canonical SMILES for 1-(5-amino-6-isocyanopyrazin-2-yl)propane-1,2-diol is [C-]#[N+]c1nc(C(O)C(C)O)cnc1N.
What is the InChIKey of 1-(5-amino-6-isocyanopyrazin-2-yl)propane-1,2-diol?
The InChIKey is PHAODQGCZCEMRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4O2/c1-4(13)6(14)5-3-11-7(9)8(10-2)12-5/h3-4,6,13-14H,1H3,(H2,9,11).
What are the key properties of 1-(5-amino-6-isocyanopyrazin-2-yl)propane-1,2-diol?
1-(5-amino-6-isocyanopyrazin-2-yl)propane-1,2-diol has a molecular weight of 194.19 g/mol, XLogP of 0.02, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-amino-6-isocyanopyrazin-2-yl)propane-1,2-diol is sourced from PubChem (CID 165160308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).